C53H28N4 — CID 59565907
4-[2',7,7'-tris(4-cyanophenyl)-9,9'-spirobi[fluorene]-2-yl]benzonitrile (PubChem CID 59565907) has the molecular formula C53H28N4 and a molecular weight of 720.84 g/mol. Its IUPAC name is 4-[2',7,7'-tris(4-cyanophenyl)-9,9'-spirobi[fluorene]-2-yl]benzonitrile.
| Compound Name | 4-[2',7,7'-tris(4-cyanophenyl)-9,9'-spirobi[fluorene]-2-yl]benzonitrile |
|---|---|
| PubChem CID | 59565907 |
| Molecular Formula | C53H28N4 |
| Molecular Weight | 720.84 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | 4-[2',7,7'-tris(4-cyanophenyl)-9,9'-spirobi[fluorene]-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)C2(c4cc(-c5ccc(C#N)cc5)ccc4-3)c3cc(-c4ccc(C#N)cc4)ccc3-c3ccc(-c4ccc(C#N)cc4)cc32)cc1 |
| InChI | InChI=1S/C53H28N4/c54-29-33-1-9-37(10-2-33)41-17-21-45-46-22-18-42(38-11-3-34(30-55)4-12-38)26-50(46)53(49(45)25-41)51-27-43(39-13-5-35(31-56)6-14-39)19-23-47(51)48-24-20-44(28-52(48)53)40-15-7-36(32-57)8-16-40/h1-28H |
| InChIKey | KBYSBTUGYSREKW-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.84 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |