C59H38N4 — CID 162776206
7-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9,9-diphenylfluorene-2-carbonitrile (PubChem CID 162776206) has the molecular formula C59H38N4 and a molecular weight of 802.98 g/mol. Its IUPAC name is 7-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9,9-diphenylfluorene-2-carbonitrile.
| Compound Name | 7-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9,9-diphenylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 162776206 |
| Molecular Formula | C59H38N4 |
| Molecular Weight | 802.98 g/mol |
| Exact Mass | 802.31 |
| IUPAC Name | 7-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-9,9-diphenylfluorene-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(-c3ccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc3)ccc1-2 |
| InChI | InChI=1S/C59H38N4/c60-39-40-21-35-52-53-36-34-49(38-55(53)59(54(52)37-40,50-17-9-3-10-18-50)51-19-11-4-12-20-51)45-26-32-48(33-27-45)58-62-56(46-28-22-43(23-29-46)41-13-5-1-6-14-41)61-57(63-58)47-30-24-44(25-31-47)42-15-7-2-8-16-42/h1-38H |
| InChIKey | RGHOEJHWMMWAEI-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.98 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |