C47H30N4 — CID 139522997
4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]benzonitrile (PubChem CID 139522997) has the molecular formula C47H30N4 and a molecular weight of 650.79 g/mol. Its IUPAC name is 4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]benzonitrile.
| Compound Name | 4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]benzonitrile |
|---|---|
| PubChem CID | 139522997 |
| Molecular Formula | C47H30N4 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 4-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc2-3)cc1 |
| InChI | InChI=1S/C47H30N4/c48-31-32-21-23-33(24-22-32)36-25-27-40-41-28-26-37(46-50-44(34-13-5-1-6-14-34)49-45(51-46)35-15-7-2-8-16-35)30-43(41)47(42(40)29-36,38-17-9-3-10-18-38)39-19-11-4-12-20-39/h1-30H |
| InChIKey | OETRCGAXEIVZPR-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |