C51H32N4 — CID 159211457
4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-diphenylbenzo[g]fluoren-9-yl]benzonitrile (PubChem CID 159211457) has the molecular formula C51H32N4 and a molecular weight of 700.85 g/mol. Its IUPAC name is 4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-diphenylbenzo[g]fluoren-9-yl]benzonitrile.
| Compound Name | 4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-diphenylbenzo[g]fluoren-9-yl]benzonitrile |
|---|---|
| PubChem CID | 159211457 |
| Molecular Formula | C51H32N4 |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | 4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,7-diphenylbenzo[g]fluoren-9-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc4c2-3)cc1 |
| InChI | InChI=1S/C51H32N4/c52-33-34-25-27-35(28-26-34)38-29-30-43-45(31-38)51(39-19-9-3-10-20-39,40-21-11-4-12-22-40)46-32-44(41-23-13-14-24-42(41)47(43)46)50-54-48(36-15-5-1-6-16-36)53-49(55-50)37-17-7-2-8-18-37/h1-32H |
| InChIKey | QKGBPWMGDSCGOI-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |