C47H28N4 — CID 162776381
7'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-carbonitrile (PubChem CID 162776381) has the molecular formula C47H28N4 and a molecular weight of 648.77 g/mol. Its IUPAC name is 7'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-carbonitrile.
| Compound Name | 7'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-carbonitrile |
|---|---|
| PubChem CID | 162776381 |
| Molecular Formula | C47H28N4 |
| Molecular Weight | 648.77 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 7'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-2'-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc1-2 |
| InChI | InChI=1S/C47H28N4/c48-29-30-22-24-38-39-25-23-34(28-43(39)47(42(38)26-30)40-20-9-7-18-36(40)37-19-8-10-21-41(37)47)33-16-11-17-35(27-33)46-50-44(31-12-3-1-4-13-31)49-45(51-46)32-14-5-2-6-15-32/h1-28H |
| InChIKey | AYJCINAHRYGVBZ-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.77 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |