C41H24N4S — CID 146362213
7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-thioxanthene]-2-carbonitrile (PubChem CID 146362213) has the molecular formula C41H24N4S and a molecular weight of 604.74 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-thioxanthene]-2-carbonitrile.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-thioxanthene]-2-carbonitrile |
|---|---|
| PubChem CID | 146362213 |
| Molecular Formula | C41H24N4S |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)spiro[fluorene-9,9'-thioxanthene]-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C1(c3ccccc3Sc3ccccc31)c1cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc1-2 |
| InChI | InChI=1S/C41H24N4S/c42-25-26-19-21-30-31-22-20-29(40-44-38(27-11-3-1-4-12-27)43-39(45-40)28-13-5-2-6-14-28)24-35(31)41(34(30)23-26)32-15-7-9-17-36(32)46-37-18-10-8-16-33(37)41/h1-24H |
| InChIKey | RNTLSTCLLQPWIF-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |