C53H34N4 — CID 171421517
7-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-9,9-diphenylfluorene-2-carbonitrile (PubChem CID 171421517) has the molecular formula C53H34N4 and a molecular weight of 726.88 g/mol. Its IUPAC name is 7-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-9,9-diphenylfluorene-2-carbonitrile.
| Compound Name | 7-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-9,9-diphenylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 171421517 |
| Molecular Formula | C53H34N4 |
| Molecular Weight | 726.88 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | 7-[3-(4,6-diphenylpyrimidin-2-yl)-5-pyridin-2-ylphenyl]-9,9-diphenylfluorene-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(-c3cc(-c4ccccn4)cc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)ccc1-2 |
| InChI | InChI=1S/C53H34N4/c54-35-36-24-26-45-46-27-25-39(33-48(46)53(47(45)29-36,43-19-9-3-10-20-43)44-21-11-4-12-22-44)40-30-41(49-23-13-14-28-55-49)32-42(31-40)52-56-50(37-15-5-1-6-16-37)34-51(57-52)38-17-7-2-8-18-38/h1-34H |
| InChIKey | IFSXYVFOWUSMQM-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.88 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |