C29H18N2 — CID 118408607
2,7-dimethyl-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile (PubChem CID 118408607) has the molecular formula C29H18N2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2,7-dimethyl-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile.
| Compound Name | 2,7-dimethyl-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile |
|---|---|
| PubChem CID | 118408607 |
| Molecular Formula | C29H18N2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2,7-dimethyl-9,9'-spirobi[fluorene]-2',7'-dicarbonitrile |
| SMILES | Cc1ccc2c(c1)C1(c3cc(C)ccc3-2)c2cc(C#N)ccc2-c2ccc(C#N)cc21 |
| InChI | InChI=1S/C29H18N2/c1-17-3-7-21-22-8-4-18(2)12-26(22)29(25(21)11-17)27-13-19(15-30)5-9-23(27)24-10-6-20(16-31)14-28(24)29/h3-14H,1-2H3 |
| InChIKey | BMGXKXFTEJHRLE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |