C17H15N — CID 129176208
7,9,9-trimethylfluorene-2-carbonitrile (PubChem CID 129176208) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 7,9,9-trimethylfluorene-2-carbonitrile.
| Compound Name | 7,9,9-trimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 129176208 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 7,9,9-trimethylfluorene-2-carbonitrile |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(C#N)ccc1-2 |
| InChI | InChI=1S/C17H15N/c1-11-4-6-13-14-7-5-12(10-18)9-16(14)17(2,3)15(13)8-11/h4-9H,1-3H3 |
| InChIKey | NRXCIWYWTBFEJP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |