C38H34 — CID 58943521
2,9,9-trimethyl-7-[3-(7,9,9-trimethylfluoren-2-yl)phenyl]fluorene (PubChem CID 58943521) has the molecular formula C38H34 and a molecular weight of 490.69 g/mol. Its IUPAC name is 2,9,9-trimethyl-7-[3-(7,9,9-trimethylfluoren-2-yl)phenyl]fluorene.
| Compound Name | 2,9,9-trimethyl-7-[3-(7,9,9-trimethylfluoren-2-yl)phenyl]fluorene |
|---|---|
| PubChem CID | 58943521 |
| Molecular Formula | C38H34 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 2,9,9-trimethyl-7-[3-(7,9,9-trimethylfluoren-2-yl)phenyl]fluorene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3cccc(-c4ccc5c(c4)C(C)(C)c4cc(C)ccc4-5)c3)ccc1-2 |
| InChI | InChI=1S/C38H34/c1-23-10-14-29-31-16-12-27(21-35(31)37(3,4)33(29)18-23)25-8-7-9-26(20-25)28-13-17-32-30-15-11-24(2)19-34(30)38(5,6)36(32)22-28/h7-22H,1-6H3 |
| InChIKey | XJAUVNFZKBIUMF-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |