C66H60 — CID 142541100
9,9-dimethyl-2-(4-methylphenyl)fluorene;1-methyl-4-phenylbenzene;2,6,6,12,12-pentamethyl-7-phenylindeno[1,2-b]fluorene (PubChem CID 142541100) has the molecular formula C66H60 and a molecular weight of 853.21 g/mol. Its IUPAC name is 9,9-dimethyl-2-(4-methylphenyl)fluorene;1-methyl-4-phenylbenzene;2,6,6,12,12-pentamethyl-7-phenylindeno[1,2-b]fluorene.
| Compound Name | 9,9-dimethyl-2-(4-methylphenyl)fluorene;1-methyl-4-phenylbenzene;2,6,6,12,12-pentamethyl-7-phenylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 142541100 |
| Molecular Formula | C66H60 |
| Molecular Weight | 853.21 g/mol |
| Exact Mass | 852.47 |
| IUPAC Name | 9,9-dimethyl-2-(4-methylphenyl)fluorene;1-methyl-4-phenylbenzene;2,6,6,12,12-pentamethyl-7-phenylindeno[1,2-b]fluorene |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1.Cc1ccc(-c2ccccc2)cc1.Cc1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1c(-c2ccccc2)cccc1-3 |
| InChI | InChI=1S/C31H28.C22H20.C13H12/c1-19-14-15-22-24-17-28-25(18-27(24)30(2,3)26(22)16-19)23-13-9-12-21(29(23)31(28,4)5)20-10-7-6-8-11-20;1-15-8-10-16(11-9-15)17-12-13-19-18-6-4-5-7-20(18)22(2,3)21(19)14-17;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h6-18H,1-5H3;4-14H,1-3H3;2-10H,1H3 |
| InChIKey | OJXLJSJKXYSFAN-UHFFFAOYSA-N |
| XLogP | 17.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.21 |
| LogP ≤ 5 | 17.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |