C21H14N2O — CID 68530423
5-hydroxy-7,7-dimethylbenzo[g]fluorene-3,9-dicarbonitrile (PubChem CID 68530423) has the molecular formula C21H14N2O and a molecular weight of 310.36 g/mol. Its IUPAC name is 5-hydroxy-7,7-dimethylbenzo[g]fluorene-3,9-dicarbonitrile.
| Compound Name | 5-hydroxy-7,7-dimethylbenzo[g]fluorene-3,9-dicarbonitrile |
|---|---|
| PubChem CID | 68530423 |
| Molecular Formula | C21H14N2O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-hydroxy-7,7-dimethylbenzo[g]fluorene-3,9-dicarbonitrile |
| SMILES | CC1(C)c2cc(C#N)ccc2-c2c1cc(O)c1cc(C#N)ccc21 |
| InChI | InChI=1S/C21H14N2O/c1-21(2)17-8-13(11-23)4-6-15(17)20-14-5-3-12(10-22)7-16(14)19(24)9-18(20)21/h3-9,24H,1-2H3 |
| InChIKey | LPYMYHYXYSGDBQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |