About 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol
3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol (PubChem CID 170123001) has the molecular formula C21H20O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol.
Molecular Properties
| Compound Name | 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol |
| PubChem CID | 170123001 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol |
| SMILES | COc1ccc2c3c(cc(O)c2c1)C(C)(C)c1cc(C)ccc1-3 |
| InChI | InChI=1S/C21H20O2/c1-12-5-7-15-17(9-12)21(2,3)18-11-19(22)16-10-13(23-4)6-8-14(16)20(15)18/h5-11,22H,1-4H3 |
| InChIKey | RSYUSTJDFHHKID-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol?
The IUPAC name of 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol (CID 170123001) is 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol.
What is the SMILES notation for 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol?
The canonical SMILES for 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol is COc1ccc2c3c(cc(O)c2c1)C(C)(C)c1cc(C)ccc1-3.
What is the InChIKey of 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol?
The InChIKey is RSYUSTJDFHHKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O2/c1-12-5-7-15-17(9-12)21(2,3)18-11-19(22)16-10-13(23-4)6-8-14(16)20(15)18/h5-11,22H,1-4H3.
What are the key properties of 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol?
3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol has a molecular weight of 304.39 g/mol, XLogP of 5.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-7,7,9-trimethylbenzo[c]fluoren-5-ol is sourced from PubChem (CID 170123001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).