C22H22O4 — CID 168870668
3,4,9-trimethoxy-11,11-dimethylbenzo[a]fluoren-6-ol (PubChem CID 168870668) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 3,4,9-trimethoxy-11,11-dimethylbenzo[a]fluoren-6-ol.
| Compound Name | 3,4,9-trimethoxy-11,11-dimethylbenzo[a]fluoren-6-ol |
|---|---|
| PubChem CID | 168870668 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3,4,9-trimethoxy-11,11-dimethylbenzo[a]fluoren-6-ol |
| SMILES | COc1ccc2c(c1)C(C)(C)c1c-2c(O)cc2c(OC)c(OC)ccc12 |
| InChI | InChI=1S/C22H22O4/c1-22(2)16-10-12(24-3)6-7-14(16)19-17(23)11-15-13(20(19)22)8-9-18(25-4)21(15)26-5/h6-11,23H,1-5H3 |
| InChIKey | LBTHRRGHSYEQFS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |