C17H17FO2 — CID 147991606
7-fluoro-2,4-dimethoxy-9,9-dimethylfluorene (PubChem CID 147991606) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is 7-fluoro-2,4-dimethoxy-9,9-dimethylfluorene.
| Compound Name | 7-fluoro-2,4-dimethoxy-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 147991606 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 7-fluoro-2,4-dimethoxy-9,9-dimethylfluorene |
| SMILES | COc1cc(OC)c2c(c1)C(C)(C)c1cc(F)ccc1-2 |
| InChI | InChI=1S/C17H17FO2/c1-17(2)13-7-10(18)5-6-12(13)16-14(17)8-11(19-3)9-15(16)20-4/h5-9H,1-4H3 |
| InChIKey | IVEHGMLXEVTQSK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |