C15H11ClF2 — CID 156704590
7-chloro-2,4-difluoro-9,9-dimethylfluorene (PubChem CID 156704590) has the molecular formula C15H11ClF2 and a molecular weight of 264.70 g/mol. Its IUPAC name is 7-chloro-2,4-difluoro-9,9-dimethylfluorene.
| Compound Name | 7-chloro-2,4-difluoro-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 156704590 |
| Molecular Formula | C15H11ClF2 |
| Molecular Weight | 264.70 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 7-chloro-2,4-difluoro-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(Cl)ccc2-c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C15H11ClF2/c1-15(2)11-5-8(16)3-4-10(11)14-12(15)6-9(17)7-13(14)18/h3-7H,1-2H3 |
| InChIKey | VYBMUBKDYKXKGS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |