C17H17Cl — CID 176836204
4-chloro-9,9-dimethyl-2,7-bis(trideuteriomethyl)fluorene (PubChem CID 176836204) has the molecular formula C17H17Cl and a molecular weight of 262.81 g/mol. Its IUPAC name is 4-chloro-9,9-dimethyl-2,7-bis(trideuteriomethyl)fluorene.
| Compound Name | 4-chloro-9,9-dimethyl-2,7-bis(trideuteriomethyl)fluorene |
|---|---|
| PubChem CID | 176836204 |
| Molecular Formula | C17H17Cl |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-chloro-9,9-dimethyl-2,7-bis(trideuteriomethyl)fluorene |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)C(C)(C)c1cc(C([2H])([2H])[2H])cc(Cl)c1-2 |
| InChI | InChI=1S/C17H17Cl/c1-10-5-6-12-13(7-10)17(3,4)14-8-11(2)9-15(18)16(12)14/h5-9H,1-4H3/i1D3,2D3 |
| InChIKey | DNSBLMVCRATNST-WFGJKAKNSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |