C36H40 — CID 58986962
2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-methylphenyl)phenyl]fluorene (PubChem CID 58986962) has the molecular formula C36H40 and a molecular weight of 472.72 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-methylphenyl)phenyl]fluorene.
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-methylphenyl)phenyl]fluorene |
|---|---|
| PubChem CID | 58986962 |
| Molecular Formula | C36H40 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-methylphenyl)phenyl]fluorene |
| SMILES | Cc1ccc(-c2ccc(-c3cc(C(C)(C)C)cc4c3-c3ccc(C(C)(C)C)cc3C4(C)C)cc2)cc1 |
| InChI | InChI=1S/C36H40/c1-23-10-12-24(13-11-23)25-14-16-26(17-15-25)30-20-28(35(5,6)7)22-32-33(30)29-19-18-27(34(2,3)4)21-31(29)36(32,8)9/h10-22H,1-9H3 |
| InChIKey | CGCPVCVWHUPSGH-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |