C36H44O2 — CID 118933480
4-[4-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]butyl prop-2-enoate (PubChem CID 118933480) has the molecular formula C36H44O2 and a molecular weight of 508.75 g/mol. Its IUPAC name is 4-[4-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]butyl prop-2-enoate.
| Compound Name | 4-[4-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]butyl prop-2-enoate |
|---|---|
| PubChem CID | 118933480 |
| Molecular Formula | C36H44O2 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | 4-[4-(2,7-ditert-butyl-9,9-dimethylfluoren-4-yl)phenyl]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1ccc(-c2cc(C(C)(C)C)cc3c2-c2ccc(C(C)(C)C)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C36H44O2/c1-10-32(37)38-20-12-11-13-24-14-16-25(17-15-24)29-21-27(35(5,6)7)23-31-33(29)28-19-18-26(34(2,3)4)22-30(28)36(31,8)9/h10,14-19,21-23H,1,11-13,20H2,2-9H3 |
| InChIKey | MOXILNOZHXAEKP-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|