C57H50O2 — CID 118654982
3-[2-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-7-fluoranthen-3-yl-9-prop-1-en-2-ylfluoren-9-yl]propyl prop-2-enoate (PubChem CID 118654982) has the molecular formula C57H50O2 and a molecular weight of 767.02 g/mol. Its IUPAC name is 3-[2-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-7-fluoranthen-3-yl-9-prop-1-en-2-ylfluoren-9-yl]propyl prop-2-enoate.
| Compound Name | 3-[2-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-7-fluoranthen-3-yl-9-prop-1-en-2-ylfluoren-9-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 118654982 |
| Molecular Formula | C57H50O2 |
| Molecular Weight | 767.02 g/mol |
| Exact Mass | 766.38 |
| IUPAC Name | 3-[2-(7-tert-butyl-9,9-dimethylfluoren-2-yl)-7-fluoranthen-3-yl-9-prop-1-en-2-ylfluoren-9-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1(C(=C)C)c2cc(-c3ccc4c(c3)C(C)(C)c3cc(C(C)(C)C)ccc3-4)ccc2-c2ccc(-c3ccc4c5c(cccc35)-c3ccccc3-4)cc21 |
| InChI | InChI=1S/C57H50O2/c1-9-53(58)59-29-13-28-57(34(2)3)51-31-36(35-18-22-42-43-25-21-38(55(4,5)6)33-50(43)56(7,8)49(42)30-35)19-23-44(51)45-24-20-37(32-52(45)57)39-26-27-48-41-15-11-10-14-40(41)47-17-12-16-46(39)54(47)48/h9-12,14-27,30-33H,1-2,13,28-29H2,3-8H3 |
| InChIKey | BNYSFMAJKHHREA-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.02 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|