C45H44O2 — CID 118655221
5-[9-but-1-en-2-yl-2-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate (PubChem CID 118655221) has the molecular formula C45H44O2 and a molecular weight of 616.85 g/mol. Its IUPAC name is 5-[9-but-1-en-2-yl-2-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate.
| Compound Name | 5-[9-but-1-en-2-yl-2-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 118655221 |
| Molecular Formula | C45H44O2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | 5-[9-but-1-en-2-yl-2-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1(C(=C)CC)c2ccccc2-c2ccc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)cc21 |
| InChI | InChI=1S/C45H44O2/c1-7-29(3)45(24-12-9-13-25-47-41(46)8-2)39-15-11-10-14-36(39)37-22-19-31(28-40(37)45)35-21-18-30-16-17-32-26-34(44(4,5)6)27-33-20-23-38(35)43(30)42(32)33/h8,10-11,14-23,26-28H,2-3,7,9,12-13,24-25H2,1,4-6H3 |
| InChIKey | DVQYAWCUDHGVOE-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|