C53H49F9O4 — CID 134419475
5-[2-(7-tert-butylpyren-1-yl)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate (PubChem CID 134419475) has the molecular formula C53H49F9O4 and a molecular weight of 920.95 g/mol. Its IUPAC name is 5-[2-(7-tert-butylpyren-1-yl)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate.
| Compound Name | 5-[2-(7-tert-butylpyren-1-yl)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 134419475 |
| Molecular Formula | C53H49F9O4 |
| Molecular Weight | 920.95 g/mol |
| Exact Mass | 920.35 |
| IUPAC Name | 5-[2-(7-tert-butylpyren-1-yl)-7-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-9-(5-prop-2-enoyloxypentyl)fluoren-9-yl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1(CCCCCOC(=O)C=C)c2cc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)ccc2-c2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C53H49F9O4/c1-6-44(63)65-26-12-8-10-24-49(25-11-9-13-27-66-45(64)7-2)42-30-33(38-20-16-32-14-15-34-28-37(48(3,4)5)29-35-18-22-41(38)47(32)46(34)35)17-21-39(42)40-23-19-36(31-43(40)49)50(54,55)51(56,57)52(58,59)53(60,61)62/h6-7,14-23,28-31H,1-2,8-13,24-27H2,3-5H3 |
| InChIKey | ULOILIHWBDRDKU-UHFFFAOYSA-N |
| XLogP | 15.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.95 |
| LogP ≤ 5 | 15.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|