C47H38O4 — CID 118655192
2-[6-[7-tert-butyl-3-(6-ethenoxynaphthalen-2-yl)pyren-1-yl]naphthalen-2-yl]oxyethyl prop-2-enoate (PubChem CID 118655192) has the molecular formula C47H38O4 and a molecular weight of 666.82 g/mol. Its IUPAC name is 2-[6-[7-tert-butyl-3-(6-ethenoxynaphthalen-2-yl)pyren-1-yl]naphthalen-2-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[6-[7-tert-butyl-3-(6-ethenoxynaphthalen-2-yl)pyren-1-yl]naphthalen-2-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 118655192 |
| Molecular Formula | C47H38O4 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | 2-[6-[7-tert-butyl-3-(6-ethenoxynaphthalen-2-yl)pyren-1-yl]naphthalen-2-yl]oxyethyl prop-2-enoate |
| SMILES | C=COc1ccc2cc(-c3cc(-c4ccc5cc(OCCOC(=O)C=C)ccc5c4)c4ccc5cc(C(C)(C)C)cc6ccc3c4c65)ccc2c1 |
| InChI | InChI=1S/C47H38O4/c1-6-44(48)51-21-20-50-39-17-13-30-23-34(11-9-32(30)27-39)43-28-42(33-10-8-31-26-38(49-7-2)16-12-29(31)22-33)40-18-14-35-24-37(47(3,4)5)25-36-15-19-41(43)46(40)45(35)36/h6-19,22-28H,1-2,20-21H2,3-5H3 |
| InChIKey | YZXNGYNFNBNCIG-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|