C56H44O6Si — CID 169107836
2-[4-[6-[dimethyl-[6-[4-(2-prop-2-enoyloxyethoxy)phenyl]pyren-1-yl]silyl]pyren-1-yl]phenoxy]ethyl prop-2-enoate (PubChem CID 169107836) has the molecular formula C56H44O6Si and a molecular weight of 841.05 g/mol. Its IUPAC name is 2-[4-[6-[dimethyl-[6-[4-(2-prop-2-enoyloxyethoxy)phenyl]pyren-1-yl]silyl]pyren-1-yl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[6-[dimethyl-[6-[4-(2-prop-2-enoyloxyethoxy)phenyl]pyren-1-yl]silyl]pyren-1-yl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 169107836 |
| Molecular Formula | C56H44O6Si |
| Molecular Weight | 841.05 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | 2-[4-[6-[dimethyl-[6-[4-(2-prop-2-enoyloxyethoxy)phenyl]pyren-1-yl]silyl]pyren-1-yl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(-c2ccc3ccc4c([Si](C)(C)c5ccc6ccc7c(-c8ccc(OCCOC(=O)C=C)cc8)ccc8ccc5c6c87)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C56H44O6Si/c1-5-51(57)61-33-31-59-41-19-7-35(8-20-41)43-23-11-37-15-27-47-49(29-17-39-13-25-45(43)53(37)55(39)47)63(3,4)50-30-18-40-14-26-46-44(24-12-38-16-28-48(50)56(40)54(38)46)36-9-21-42(22-10-36)60-32-34-62-52(58)6-2/h5-30H,1-2,31-34H2,3-4H3 |
| InChIKey | TVZRBUQGGFIVRO-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.05 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|