C52H50O8 — CID 118933517
3-[3-[3-[3,5-bis(prop-2-enoyloxymethyl)phenyl]-7-tert-butylpyren-1-yl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate (PubChem CID 118933517) has the molecular formula C52H50O8 and a molecular weight of 802.96 g/mol. Its IUPAC name is 3-[3-[3-[3,5-bis(prop-2-enoyloxymethyl)phenyl]-7-tert-butylpyren-1-yl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate.
| Compound Name | 3-[3-[3-[3,5-bis(prop-2-enoyloxymethyl)phenyl]-7-tert-butylpyren-1-yl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 118933517 |
| Molecular Formula | C52H50O8 |
| Molecular Weight | 802.96 g/mol |
| Exact Mass | 802.35 |
| IUPAC Name | 3-[3-[3-[3,5-bis(prop-2-enoyloxymethyl)phenyl]-7-tert-butylpyren-1-yl]-5-(3-prop-2-enoyloxypropyl)phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1cc(CCCOC(=O)C=C)cc(-c2cc(-c3cc(COC(=O)C=C)cc(COC(=O)C=C)c3)c3ccc4cc(C(C)(C)C)cc5ccc2c3c54)c1 |
| InChI | InChI=1S/C52H50O8/c1-8-46(53)57-20-12-14-33-22-34(15-13-21-58-47(54)9-2)25-39(24-33)44-30-45(40-26-35(31-59-48(55)10-3)23-36(27-40)32-60-49(56)11-4)43-19-17-38-29-41(52(5,6)7)28-37-16-18-42(44)51(43)50(37)38/h8-11,16-19,22-30H,1-4,12-15,20-21,31-32H2,5-7H3 |
| InChIKey | RBKRRNYBKPLRBY-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.96 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|