C60H55BrO2 — CID 129056178
5-[2-(7-bromo-9,9-dimethylfluoren-2-yl)-9-but-1-en-2-yl-7-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate (PubChem CID 129056178) has the molecular formula C60H55BrO2 and a molecular weight of 888.00 g/mol. Its IUPAC name is 5-[2-(7-bromo-9,9-dimethylfluoren-2-yl)-9-but-1-en-2-yl-7-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate.
| Compound Name | 5-[2-(7-bromo-9,9-dimethylfluoren-2-yl)-9-but-1-en-2-yl-7-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 129056178 |
| Molecular Formula | C60H55BrO2 |
| Molecular Weight | 888.00 g/mol |
| Exact Mass | 886.34 |
| IUPAC Name | 5-[2-(7-bromo-9,9-dimethylfluoren-2-yl)-9-but-1-en-2-yl-7-(7-tert-butylpyren-1-yl)fluoren-9-yl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1(C(=C)CC)c2cc(-c3ccc4c(c3)C(C)(C)c3cc(Br)ccc3-4)ccc2-c2ccc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)cc21 |
| InChI | InChI=1S/C60H55BrO2/c1-9-36(3)60(28-12-11-13-29-63-55(62)10-2)53-33-39(38-17-23-46-47-27-21-44(61)35-52(47)59(7,8)51(46)32-38)18-24-48(53)49-25-19-40(34-54(49)60)45-22-16-37-14-15-41-30-43(58(4,5)6)31-42-20-26-50(45)57(37)56(41)42/h10,14-27,30-35H,2-3,9,11-13,28-29H2,1,4-8H3 |
| InChIKey | REGTYUKPQWCGNM-UHFFFAOYSA-N |
| XLogP | 16.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.00 |
| LogP ≤ 5 | 16.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|