C69H66O4 — CID 118652588
4-[2,7-bis(7-tert-butylpyren-1-yl)-9-[1-(2-methylprop-2-enoyloxy)butyl]fluoren-9-yl]butyl 2-methylprop-2-enoate (PubChem CID 118652588) has the molecular formula C69H66O4 and a molecular weight of 959.28 g/mol. Its IUPAC name is 4-[2,7-bis(7-tert-butylpyren-1-yl)-9-[1-(2-methylprop-2-enoyloxy)butyl]fluoren-9-yl]butyl 2-methylprop-2-enoate.
| Compound Name | 4-[2,7-bis(7-tert-butylpyren-1-yl)-9-[1-(2-methylprop-2-enoyloxy)butyl]fluoren-9-yl]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118652588 |
| Molecular Formula | C69H66O4 |
| Molecular Weight | 959.28 g/mol |
| Exact Mass | 958.50 |
| IUPAC Name | 4-[2,7-bis(7-tert-butylpyren-1-yl)-9-[1-(2-methylprop-2-enoyloxy)butyl]fluoren-9-yl]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCC1(C(CCC)OC(=O)C(=C)C)c2cc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)ccc2-c2ccc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)cc21 |
| InChI | InChI=1S/C69H66O4/c1-12-15-60(73-66(71)41(4)5)69(32-13-14-33-72-65(70)40(2)3)58-38-44(52-26-20-42-16-18-46-34-50(67(6,7)8)36-48-24-30-56(52)63(42)61(46)48)22-28-54(58)55-29-23-45(39-59(55)69)53-27-21-43-17-19-47-35-51(68(9,10)11)37-49-25-31-57(53)64(43)62(47)49/h16-31,34-39,60H,2,4,12-15,32-33H2,1,3,5-11H3 |
| InChIKey | KEHKLOSBIVMQRU-UHFFFAOYSA-N |
| XLogP | 18.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.28 |
| LogP ≤ 5 | 18.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|