C63H74O6S2 — CID 101166959
8-[4-[5-[7-[5-[4-[8-(2-methylprop-2-enoyloxy)octoxy]phenyl]thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]octyl 2-methylprop-2-enoate (PubChem CID 101166959) has the molecular formula C63H74O6S2 and a molecular weight of 991.41 g/mol. Its IUPAC name is 8-[4-[5-[7-[5-[4-[8-(2-methylprop-2-enoyloxy)octoxy]phenyl]thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]octyl 2-methylprop-2-enoate.
| Compound Name | 8-[4-[5-[7-[5-[4-[8-(2-methylprop-2-enoyloxy)octoxy]phenyl]thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101166959 |
| Molecular Formula | C63H74O6S2 |
| Molecular Weight | 991.41 g/mol |
| Exact Mass | 990.49 |
| IUPAC Name | 8-[4-[5-[7-[5-[4-[8-(2-methylprop-2-enoyloxy)octoxy]phenyl]thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(CCC)(CCC)c3cc(-c5ccc(-c6ccc(OCCCCCCCCOC(=O)C(=C)C)cc6)s5)ccc3-4)s2)cc1 |
| InChI | InChI=1S/C63H74O6S2/c1-7-37-63(38-8-2)55-43-49(59-35-33-57(70-59)47-21-27-51(28-22-47)66-39-17-13-9-11-15-19-41-68-61(64)45(3)4)25-31-53(55)54-32-26-50(44-56(54)63)60-36-34-58(71-60)48-23-29-52(30-24-48)67-40-18-14-10-12-16-20-42-69-62(65)46(5)6/h21-36,43-44H,3,5,7-20,37-42H2,1-2,4,6H3 |
| InChIKey | LHVZDUAVMRFWKE-UHFFFAOYSA-N |
| XLogP | 18.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.41 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|