C62H64O3S — CID 58112747
7-[4-[5-[1,1,3,3-tetramethyl-7'-[4-[4-(4-methylphenyl)phenyl]phenyl]spiro[cyclopentane-2,9'-fluorene]-2'-yl]thiophen-2-yl]phenoxy]heptyl 2-methylidenebutanoate (PubChem CID 58112747) has the molecular formula C62H64O3S and a molecular weight of 889.26 g/mol. Its IUPAC name is 7-[4-[5-[1,1,3,3-tetramethyl-7'-[4-[4-(4-methylphenyl)phenyl]phenyl]spiro[cyclopentane-2,9'-fluorene]-2'-yl]thiophen-2-yl]phenoxy]heptyl 2-methylidenebutanoate.
| Compound Name | 7-[4-[5-[1,1,3,3-tetramethyl-7'-[4-[4-(4-methylphenyl)phenyl]phenyl]spiro[cyclopentane-2,9'-fluorene]-2'-yl]thiophen-2-yl]phenoxy]heptyl 2-methylidenebutanoate |
|---|---|
| PubChem CID | 58112747 |
| Molecular Formula | C62H64O3S |
| Molecular Weight | 889.26 g/mol |
| Exact Mass | 888.46 |
| IUPAC Name | 7-[4-[5-[1,1,3,3-tetramethyl-7'-[4-[4-(4-methylphenyl)phenyl]phenyl]spiro[cyclopentane-2,9'-fluorene]-2'-yl]thiophen-2-yl]phenoxy]heptyl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C3(c5cc(-c6ccc(-c7ccc(-c8ccc(C)cc8)cc7)cc6)ccc5-4)C(C)(C)CCC3(C)C)s2)cc1 |
| InChI | InChI=1S/C62H64O3S/c1-8-43(3)59(63)65-39-13-11-9-10-12-38-64-52-30-26-49(27-31-52)57-34-35-58(66-57)51-29-33-54-53-32-28-50(40-55(53)62(56(54)41-51)60(4,5)36-37-61(62,6)7)48-24-22-47(23-25-48)46-20-18-45(19-21-46)44-16-14-42(2)15-17-44/h14-35,40-41H,3,8-13,36-39H2,1-2,4-7H3 |
| InChIKey | GRDQJGNTCGZSPO-UHFFFAOYSA-N |
| XLogP | 17.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.26 |
| LogP ≤ 5 | 17.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|