C54H60O3S3 — CID 58952869
penta-1,4-dien-3-yl 11-[4-[5-[7-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]undecanoate (PubChem CID 58952869) has the molecular formula C54H60O3S3 and a molecular weight of 853.27 g/mol. Its IUPAC name is penta-1,4-dien-3-yl 11-[4-[5-[7-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]undecanoate.
| Compound Name | penta-1,4-dien-3-yl 11-[4-[5-[7-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]undecanoate |
|---|---|
| PubChem CID | 58952869 |
| Molecular Formula | C54H60O3S3 |
| Molecular Weight | 853.27 g/mol |
| Exact Mass | 852.37 |
| IUPAC Name | penta-1,4-dien-3-yl 11-[4-[5-[7-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-9,9-dipropylfluoren-2-yl]thiophen-2-yl]phenoxy]undecanoate |
| SMILES | C=CC(C=C)OC(=O)CCCCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(CCC)(CCC)c3cc(-c5ccc(-c6ccc(C)s6)s5)ccc3-4)s2)cc1 |
| InChI | InChI=1S/C54H60O3S3/c1-6-33-54(34-7-2)46-36-40(22-26-44(46)45-27-23-41(37-47(45)54)50-31-32-52(60-50)51-28-19-38(5)58-51)49-30-29-48(59-49)39-20-24-43(25-21-39)56-35-17-15-13-11-10-12-14-16-18-53(55)57-42(8-3)9-4/h8-9,19-32,36-37,42H,3-4,6-7,10-18,33-35H2,1-2,5H3 |
| InChIKey | MKULATHEIYPKJQ-UHFFFAOYSA-N |
| XLogP | 16.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.27 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|