C25H30O4 — CID 23527521
5-[(7-propoxy-9H-fluoren-2-yl)oxy]pentyl 2-methylprop-2-enoate (PubChem CID 23527521) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 5-[(7-propoxy-9H-fluoren-2-yl)oxy]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[(7-propoxy-9H-fluoren-2-yl)oxy]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23527521 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 5-[(7-propoxy-9H-fluoren-2-yl)oxy]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc2c(c1)Cc1cc(OCCC)ccc1-2 |
| InChI | InChI=1S/C25H30O4/c1-4-12-27-21-8-10-23-19(16-21)15-20-17-22(9-11-24(20)23)28-13-6-5-7-14-29-25(26)18(2)3/h8-11,16-17H,2,4-7,12-15H2,1,3H3 |
| InChIKey | MMNOTQIXQVTMKK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|