C38H45NO3 — CID 101442988
6-[9,9-dibutyl-7-(4-cyanophenyl)fluoren-2-yl]oxyhexyl 2-methylprop-2-enoate (PubChem CID 101442988) has the molecular formula C38H45NO3 and a molecular weight of 563.78 g/mol. Its IUPAC name is 6-[9,9-dibutyl-7-(4-cyanophenyl)fluoren-2-yl]oxyhexyl 2-methylprop-2-enoate.
| Compound Name | 6-[9,9-dibutyl-7-(4-cyanophenyl)fluoren-2-yl]oxyhexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101442988 |
| Molecular Formula | C38H45NO3 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | 6-[9,9-dibutyl-7-(4-cyanophenyl)fluoren-2-yl]oxyhexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc2c(c1)C(CCCC)(CCCC)c1cc(-c3ccc(C#N)cc3)ccc1-2 |
| InChI | InChI=1S/C38H45NO3/c1-5-7-21-38(22-8-6-2)35-25-31(30-15-13-29(27-39)14-16-30)17-19-33(35)34-20-18-32(26-36(34)38)41-23-11-9-10-12-24-42-37(40)28(3)4/h13-20,25-26H,3,5-12,21-24H2,1-2,4H3 |
| InChIKey | XWSRLYRXGQFNTE-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|