C67H60F6O2 — CID 129056189
[5-[2,7-bis(7-tert-butylpyren-1-yl)-9-(5,5,5-trifluoropentyl)fluoren-9-yl]-2-(trifluoromethyl)pentyl] prop-2-enoate (PubChem CID 129056189) has the molecular formula C67H60F6O2 and a molecular weight of 1011.20 g/mol. Its IUPAC name is [5-[2,7-bis(7-tert-butylpyren-1-yl)-9-(5,5,5-trifluoropentyl)fluoren-9-yl]-2-(trifluoromethyl)pentyl] prop-2-enoate.
| Compound Name | [5-[2,7-bis(7-tert-butylpyren-1-yl)-9-(5,5,5-trifluoropentyl)fluoren-9-yl]-2-(trifluoromethyl)pentyl] prop-2-enoate |
|---|---|
| PubChem CID | 129056189 |
| Molecular Formula | C67H60F6O2 |
| Molecular Weight | 1011.20 g/mol |
| Exact Mass | 1010.45 |
| IUPAC Name | [5-[2,7-bis(7-tert-butylpyren-1-yl)-9-(5,5,5-trifluoropentyl)fluoren-9-yl]-2-(trifluoromethyl)pentyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCCC1(CCCCC(F)(F)F)c2cc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)ccc2-c2ccc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)cc21)C(F)(F)F |
| InChI | InChI=1S/C67H60F6O2/c1-8-58(74)75-38-47(67(71,72)73)12-11-30-65(29-9-10-31-66(68,69)70)56-36-41(50-23-17-39-13-15-43-32-48(63(2,3)4)34-45-21-27-54(50)61(39)59(43)45)19-25-52(56)53-26-20-42(37-57(53)65)51-24-18-40-14-16-44-33-49(64(5,6)7)35-46-22-28-55(51)62(40)60(44)46/h8,13-28,32-37,47H,1,9-12,29-31,38H2,2-7H3 |
| InChIKey | ZOZHTANPYSKFMR-UHFFFAOYSA-N |
| XLogP | 19.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.20 |
| LogP ≤ 5 | 19.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|