C56H54O2 — CID 90400378
4-[2-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(4-hydroxybutyl)fluoren-9-yl]butan-1-ol (PubChem CID 90400378) has the molecular formula C56H54O2 and a molecular weight of 759.05 g/mol. Its IUPAC name is 4-[2-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(4-hydroxybutyl)fluoren-9-yl]butan-1-ol.
| Compound Name | 4-[2-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(4-hydroxybutyl)fluoren-9-yl]butan-1-ol |
|---|---|
| PubChem CID | 90400378 |
| Molecular Formula | C56H54O2 |
| Molecular Weight | 759.05 g/mol |
| Exact Mass | 758.41 |
| IUPAC Name | 4-[2-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-9-(4-hydroxybutyl)fluoren-9-yl]butan-1-ol |
| SMILES | CC(C)(C)c1cc2ccc3ccc(-c4ccc5c(c4)C(C)(C)c4cc(-c6ccc7c(c6)C(CCCCO)(CCCCO)c6ccccc6-7)ccc4-5)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C56H54O2/c1-54(2,3)41-30-39-15-14-35-16-21-42(47-25-20-40(31-41)52(39)53(35)47)38-19-24-45-44-22-17-36(32-49(44)55(4,5)50(45)34-38)37-18-23-46-43-12-6-7-13-48(43)56(51(46)33-37,26-8-10-28-57)27-9-11-29-58/h6-7,12-25,30-34,57-58H,8-11,26-29H2,1-5H3 |
| InChIKey | QGKUANHQQCKFJK-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.05 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|