C53H48O — CID 90398118
3-[7-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-9,9-dimethylfluoren-2-yl]propan-1-ol (PubChem CID 90398118) has the molecular formula C53H48O and a molecular weight of 700.97 g/mol. Its IUPAC name is 3-[7-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-9,9-dimethylfluoren-2-yl]propan-1-ol.
| Compound Name | 3-[7-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-9,9-dimethylfluoren-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 90398118 |
| Molecular Formula | C53H48O |
| Molecular Weight | 700.97 g/mol |
| Exact Mass | 700.37 |
| IUPAC Name | 3-[7-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]-9,9-dimethylfluoren-2-yl]propan-1-ol |
| SMILES | CC(C)(C)c1cc2ccc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc(-c4ccc5c(c4)C(C)(C)c4cc(CCCO)ccc4-5)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C53H48O/c1-51(2,3)36-26-34-17-22-41-43(32-15-20-39-37-12-8-9-13-45(37)52(4,5)47(39)28-32)30-44(42-23-18-35(27-36)49(34)50(41)42)33-16-21-40-38-19-14-31(11-10-24-54)25-46(38)53(6,7)48(40)29-33/h8-9,12-23,25-30,54H,10-11,24H2,1-7H3 |
| InChIKey | WEKYBZRKRDSRLD-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.97 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|