C44H38 — CID 58402162
17-tert-butyl-6-(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene (PubChem CID 58402162) has the molecular formula C44H38 and a molecular weight of 566.79 g/mol. Its IUPAC name is 17-tert-butyl-6-(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene.
| Compound Name | 17-tert-butyl-6-(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene |
|---|---|
| PubChem CID | 58402162 |
| Molecular Formula | C44H38 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 17-tert-butyl-6-(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene |
| SMILES | CC(C)(C)c1cc2ccc3cc4c(c5ccc(c1)c2c35)-c1ccc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1C4(C)C |
| InChI | InChI=1S/C44H38/c1-42(2,3)30-20-27-12-13-29-24-38-41(34-19-16-28(21-30)39(27)40(29)34)33-18-15-26(23-37(33)44(38,6)7)25-14-17-32-31-10-8-9-11-35(31)43(4,5)36(32)22-25/h8-24H,1-7H3 |
| InChIKey | GPXOECQCGJWHAD-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|