C33H28N2 — CID 58402156
2-(17-tert-butyl-9,9-dimethyl-6-hexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaenyl)pyrimidine (PubChem CID 58402156) has the molecular formula C33H28N2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-(17-tert-butyl-9,9-dimethyl-6-hexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaenyl)pyrimidine.
| Compound Name | 2-(17-tert-butyl-9,9-dimethyl-6-hexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaenyl)pyrimidine |
|---|---|
| PubChem CID | 58402156 |
| Molecular Formula | C33H28N2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-(17-tert-butyl-9,9-dimethyl-6-hexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaenyl)pyrimidine |
| SMILES | CC(C)(C)c1cc2ccc3cc4c(c5ccc(c1)c2c35)-c1ccc(-c2ncccn2)cc1C4(C)C |
| InChI | InChI=1S/C33H28N2/c1-32(2,3)23-15-19-7-8-21-17-27-30(25-12-9-20(16-23)28(19)29(21)25)24-11-10-22(18-26(24)33(27,4)5)31-34-13-6-14-35-31/h6-18H,1-5H3 |
| InChIKey | GIIGIOGLWBTQKY-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|