C63H62 — CID 59828084
2,7-ditert-butyl-1-[7-(2,7-ditert-butylpyren-4-yl)-9,9-dimethylfluoren-2-yl]pyrene (PubChem CID 59828084) has the molecular formula C63H62 and a molecular weight of 819.19 g/mol. Its IUPAC name is 2,7-ditert-butyl-1-[7-(2,7-ditert-butylpyren-4-yl)-9,9-dimethylfluoren-2-yl]pyrene.
| Compound Name | 2,7-ditert-butyl-1-[7-(2,7-ditert-butylpyren-4-yl)-9,9-dimethylfluoren-2-yl]pyrene |
|---|---|
| PubChem CID | 59828084 |
| Molecular Formula | C63H62 |
| Molecular Weight | 819.19 g/mol |
| Exact Mass | 818.49 |
| IUPAC Name | 2,7-ditert-butyl-1-[7-(2,7-ditert-butylpyren-4-yl)-9,9-dimethylfluoren-2-yl]pyrene |
| SMILES | CC(C)(C)c1cc2ccc3cc(C(C)(C)C)cc4c(-c5ccc6c(c5)C(C)(C)c5cc(-c7c(C(C)(C)C)cc8ccc9cc(C(C)(C)C)cc%10ccc7c8c9%10)ccc5-6)cc(c1)c2c34 |
| InChI | InChI=1S/C63H62/c1-59(2,3)43-25-36-16-18-41-33-53(62(10,11)12)56(48-24-21-38(27-43)54(36)57(41)48)40-20-23-47-46-22-19-35(31-51(46)63(13,14)52(47)32-40)49-30-42-29-44(60(4,5)6)26-37-15-17-39-28-45(61(7,8)9)34-50(49)58(39)55(37)42/h15-34H,1-14H3 |
| InChIKey | YVSBYZHVHOYKDY-UHFFFAOYSA-N |
| XLogP | 18.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.19 |
| LogP ≤ 5 | 18.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|