C59H54 — CID 59254091
2-tert-butyl-4-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-7-(2-methylpropyl)pyrene (PubChem CID 59254091) has the molecular formula C59H54 and a molecular weight of 763.08 g/mol. Its IUPAC name is 2-tert-butyl-4-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-7-(2-methylpropyl)pyrene.
| Compound Name | 2-tert-butyl-4-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-7-(2-methylpropyl)pyrene |
|---|---|
| PubChem CID | 59254091 |
| Molecular Formula | C59H54 |
| Molecular Weight | 763.08 g/mol |
| Exact Mass | 762.42 |
| IUPAC Name | 2-tert-butyl-4-[7-(7-tert-butylpyren-1-yl)-9,9-dimethylfluoren-2-yl]-7-(2-methylpropyl)pyrene |
| SMILES | CC(C)Cc1cc2ccc3cc(C(C)(C)C)cc4c(-c5ccc6c(c5)C(C)(C)c5cc(-c7ccc8ccc9cc(C(C)(C)C)cc%10ccc7c8c9%10)ccc5-6)cc(c1)c2c34 |
| InChI | InChI=1S/C59H54/c1-33(2)23-34-24-38-13-14-41-28-44(58(6,7)8)32-50-49(29-42(25-34)54(38)56(41)50)37-17-21-47-46-20-16-36(30-51(46)59(9,10)52(47)31-37)45-19-15-35-11-12-39-26-43(57(3,4)5)27-40-18-22-48(45)55(35)53(39)40/h11-22,24-33H,23H2,1-10H3 |
| InChIKey | QHMLIJVVTWIVEZ-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.08 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|