C37H34O — CID 90398149
7-tert-butyl-1-[7-(methoxymethyl)-9,9-dimethylfluoren-2-yl]pyrene (PubChem CID 90398149) has the molecular formula C37H34O and a molecular weight of 494.68 g/mol. Its IUPAC name is 7-tert-butyl-1-[7-(methoxymethyl)-9,9-dimethylfluoren-2-yl]pyrene.
| Compound Name | 7-tert-butyl-1-[7-(methoxymethyl)-9,9-dimethylfluoren-2-yl]pyrene |
|---|---|
| PubChem CID | 90398149 |
| Molecular Formula | C37H34O |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 7-tert-butyl-1-[7-(methoxymethyl)-9,9-dimethylfluoren-2-yl]pyrene |
| SMILES | COCc1ccc2c(c1)C(C)(C)c1cc(-c3ccc4ccc5cc(C(C)(C)C)cc6ccc3c4c56)ccc1-2 |
| InChI | InChI=1S/C37H34O/c1-36(2,3)27-18-25-9-8-23-10-14-28(31-16-12-26(19-27)34(25)35(23)31)24-11-15-30-29-13-7-22(21-38-6)17-32(29)37(4,5)33(30)20-24/h7-20H,21H2,1-6H3 |
| InChIKey | KHEGJJDAVMSKMM-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|