C59H51N — CID 58402179
17-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaen-6-amine (PubChem CID 58402179) has the molecular formula C59H51N and a molecular weight of 774.06 g/mol. Its IUPAC name is 17-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaen-6-amine.
| Compound Name | 17-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaen-6-amine |
|---|---|
| PubChem CID | 58402179 |
| Molecular Formula | C59H51N |
| Molecular Weight | 774.06 g/mol |
| Exact Mass | 773.40 |
| IUPAC Name | 17-tert-butyl-N,N-bis(9,9-dimethylfluoren-2-yl)-9,9-dimethylhexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaen-6-amine |
| SMILES | CC(C)(C)c1cc2ccc3cc4c(c5ccc(c1)c2c35)-c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1C4(C)C |
| InChI | InChI=1S/C59H51N/c1-56(2,3)37-28-34-18-19-36-30-52-55(46-24-20-35(29-37)53(34)54(36)46)45-27-23-40(33-51(45)59(52,8)9)60(38-21-25-43-41-14-10-12-16-47(41)57(4,5)49(43)31-38)39-22-26-44-42-15-11-13-17-48(42)58(6,7)50(44)32-39/h10-33H,1-9H3 |
| InChIKey | LZDSTWTUJUKCDL-UHFFFAOYSA-N |
| XLogP | 16.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.06 |
| LogP ≤ 5 | 16.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|