C64H50N4 — CID 123414347
7-tert-butyl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N,3-N-bis(4-isocyanophenyl)pyrene-1,3-diamine (PubChem CID 123414347) has the molecular formula C64H50N4 and a molecular weight of 875.13 g/mol. Its IUPAC name is 7-tert-butyl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N,3-N-bis(4-isocyanophenyl)pyrene-1,3-diamine.
| Compound Name | 7-tert-butyl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N,3-N-bis(4-isocyanophenyl)pyrene-1,3-diamine |
|---|---|
| PubChem CID | 123414347 |
| Molecular Formula | C64H50N4 |
| Molecular Weight | 875.13 g/mol |
| Exact Mass | 874.40 |
| IUPAC Name | 7-tert-butyl-1-N,3-N-bis(9,9-dimethylfluoren-2-yl)-1-N,3-N-bis(4-isocyanophenyl)pyrene-1,3-diamine |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2cc(N(c3ccc([N+]#[C-])cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4cc(C(C)(C)C)cc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C64H50N4/c1-62(2,3)41-34-39-18-30-52-58(67(44-24-20-42(65-8)21-25-44)46-28-32-50-48-14-10-12-16-54(48)63(4,5)56(50)36-46)38-59(53-31-19-40(35-41)60(39)61(52)53)68(45-26-22-43(66-9)23-27-45)47-29-33-51-49-15-11-13-17-55(49)64(6,7)57(51)37-47/h10-38H,1-7H3 |
| InChIKey | RXYQILISVGAQER-UHFFFAOYSA-N |
| XLogP | 18.54 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.13 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|