C44H36N+ — CID 58028912
3-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]quinolizin-5-ium (PubChem CID 58028912) has the molecular formula C44H36N+ and a molecular weight of 578.78 g/mol. Its IUPAC name is 3-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]quinolizin-5-ium.
| Compound Name | 3-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]quinolizin-5-ium |
|---|---|
| PubChem CID | 58028912 |
| Molecular Formula | C44H36N+ |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 3-[7-tert-butyl-3-(9,9-dimethylfluoren-2-yl)pyren-1-yl]quinolizin-5-ium |
| SMILES | CC(C)(C)c1cc2ccc3c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc(-c4ccc5cccc[n+]5c4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C44H36N/c1-43(2,3)31-22-28-15-19-35-37(27-14-18-34-33-11-6-7-12-39(33)44(4,5)40(34)24-27)25-38(36-20-16-29(23-31)41(28)42(35)36)30-13-17-32-10-8-9-21-45(32)26-30/h6-26H,1-5H3/q+1 |
| InChIKey | ILYPGPALIDKCRX-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 4.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|