C60H50F6O2 — CID 129056164
5-[9-but-1-en-2-yl-2-[7-(7-tert-butylpyren-1-yl)-9,9-bis(trifluoromethyl)fluoren-2-yl]fluoren-9-yl]pentyl prop-2-enoate (PubChem CID 129056164) has the molecular formula C60H50F6O2 and a molecular weight of 917.05 g/mol. Its IUPAC name is 5-[9-but-1-en-2-yl-2-[7-(7-tert-butylpyren-1-yl)-9,9-bis(trifluoromethyl)fluoren-2-yl]fluoren-9-yl]pentyl prop-2-enoate.
| Compound Name | 5-[9-but-1-en-2-yl-2-[7-(7-tert-butylpyren-1-yl)-9,9-bis(trifluoromethyl)fluoren-2-yl]fluoren-9-yl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 129056164 |
| Molecular Formula | C60H50F6O2 |
| Molecular Weight | 917.05 g/mol |
| Exact Mass | 916.37 |
| IUPAC Name | 5-[9-but-1-en-2-yl-2-[7-(7-tert-butylpyren-1-yl)-9,9-bis(trifluoromethyl)fluoren-2-yl]fluoren-9-yl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1(C(=C)CC)c2ccccc2-c2ccc(-c3ccc4c(c3)C(C(F)(F)F)(C(F)(F)F)c3cc(-c5ccc6ccc7cc(C(C)(C)C)cc8ccc5c6c78)ccc3-4)cc21 |
| InChI | InChI=1S/C60H50F6O2/c1-7-35(3)57(28-12-9-13-29-68-53(67)8-2)49-15-11-10-14-44(49)45-24-19-37(32-50(45)57)38-20-25-46-47-26-21-39(34-52(47)58(51(46)33-38,59(61,62)63)60(64,65)66)43-23-18-36-16-17-40-30-42(56(4,5)6)31-41-22-27-48(43)55(36)54(40)41/h8,10-11,14-27,30-34H,2-3,7,9,12-13,28-29H2,1,4-6H3 |
| InChIKey | FWJOWPQZSDFXAR-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.05 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|