C21H32O3 — CID 545786
4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl prop-2-enoate (PubChem CID 545786) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl prop-2-enoate.
| Compound Name | 4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 545786 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 4-(3,5-ditert-butyl-4-hydroxyphenyl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H32O3/c1-8-18(22)24-12-10-9-11-15-13-16(20(2,3)4)19(23)17(14-15)21(5,6)7/h8,13-14,23H,1,9-12H2,2-7H3 |
| InChIKey | SYUKKTBPARAJJE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|