C19H30O — CID 22463031
2,6-ditert-butyl-4-pent-4-enylphenol (PubChem CID 22463031) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-pent-4-enylphenol.
| Compound Name | 2,6-ditert-butyl-4-pent-4-enylphenol |
|---|---|
| PubChem CID | 22463031 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2,6-ditert-butyl-4-pent-4-enylphenol |
| SMILES | C=CCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O/c1-8-9-10-11-14-12-15(18(2,3)4)17(20)16(13-14)19(5,6)7/h8,12-13,20H,1,9-11H2,2-7H3 |
| InChIKey | JIPIKOTXLJVROU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|