C22H30O4 — CID 102013342
3-tert-butyl-5-[2-(3-tert-butyl-4,5-dihydroxyphenyl)ethyl]benzene-1,2-diol (PubChem CID 102013342) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-tert-butyl-5-[2-(3-tert-butyl-4,5-dihydroxyphenyl)ethyl]benzene-1,2-diol.
| Compound Name | 3-tert-butyl-5-[2-(3-tert-butyl-4,5-dihydroxyphenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 102013342 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 3-tert-butyl-5-[2-(3-tert-butyl-4,5-dihydroxyphenyl)ethyl]benzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(CCc2cc(O)c(O)c(C(C)(C)C)c2)cc(O)c1O |
| InChI | InChI=1S/C22H30O4/c1-21(2,3)15-9-13(11-17(23)19(15)25)7-8-14-10-16(22(4,5)6)20(26)18(24)12-14/h9-12,23-26H,7-8H2,1-6H3 |
| InChIKey | NCACIQMPFQBYHP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|