C20H30O2 — CID 54568273
1-(3,5-ditert-butyl-4-hydroxyphenyl)hex-4-en-3-one (PubChem CID 54568273) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)hex-4-en-3-one.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)hex-4-en-3-one |
|---|---|
| PubChem CID | 54568273 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)hex-4-en-3-one |
| SMILES | CC=CC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H30O2/c1-8-9-15(21)11-10-14-12-16(19(2,3)4)18(22)17(13-14)20(5,6)7/h8-9,12-13,22H,10-11H2,1-7H3 |
| InChIKey | ZVKBAHANSKWVSY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|