C20H34O3 — CID 159967546
3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;ethene;methane (PubChem CID 159967546) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;ethene;methane.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;ethene;methane |
|---|---|
| PubChem CID | 159967546 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;ethene;methane |
| SMILES | C.C=C.CC(C)(C)c1cc(CCC(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H26O3.C2H4.CH4/c1-16(2,3)12-9-11(7-8-14(18)19)10-13(15(12)20)17(4,5)6;1-2;/h9-10,20H,7-8H2,1-6H3,(H,18,19);1-2H2;1H4 |
| InChIKey | OECZCOYLLZUNTD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|