C26H44O5 — CID 174916179
3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;octyl formate (PubChem CID 174916179) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;octyl formate.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;octyl formate |
|---|---|
| PubChem CID | 174916179 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid;octyl formate |
| SMILES | CC(C)(C)c1cc(CCC(=O)O)cc(C(C)(C)C)c1O.CCCCCCCCOC=O |
| InChI | InChI=1S/C17H26O3.C9H18O2/c1-16(2,3)12-9-11(7-8-14(18)19)10-13(15(12)20)17(4,5)6;1-2-3-4-5-6-7-8-11-9-10/h9-10,20H,7-8H2,1-6H3,(H,18,19);9H,2-8H2,1H3 |
| InChIKey | FIGHDTNOTXGPSA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|